CAS 38628-65-8: Hydroxybutynoicacid

Description:Hydroxybutynoic acid, with the CAS number 38628-65-8, is an organic compound characterized by the presence of both a hydroxyl group (-OH) and a carboxylic acid group (-COOH) within its structure, along with a triple bond between two carbon atoms, which classifies it as an alkyne. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. Hydroxybutynoic acid is known for its potential applications in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. Its unique functional groups allow for reactivity in various chemical reactions, including esterification and nucleophilic addition. Additionally, the presence of the hydroxyl group contributes to its solubility in polar solvents, while the alkyne functionality can participate in cycloaddition reactions. As with many organic acids, it may exhibit acidic properties, influencing its behavior in different chemical environments. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.

Formula:C₄H₄O₃

InChI:InChI=1/C4H4O3/c1-2-3(5)4(6)7/h1,3,5H,(H,6,7)

Synonyms:
2-Hydroxy-3-butynoic acid
2-Hydroxybut-3-Ynoic Acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Hydroxybut-3-ynoic acid REF: IN-DA003HDTCAS: 38628-65-8	97.0%	To inquire	Thu 17 Apr 25
2-Hydroxy-3-butynoic Acid REF: 3B-H0905CAS: 38628-65-8	>97.0%(T)	159.00 €~944.00 €	Tue 22 Apr 25
2-Hydroxybut-3-ynoic acid REF: 10-F667902CAS: 38628-65-8	97%	- - -	Discontinued product
2-Hydroxybut-3-ynoicacid REF: 3D-NBA62865CAS: 38628-65-8	Min. 95%	- - -	Discontinued product