CAS 38629-93-5

2-(2,6-dimethylphenoxy)aniline

Description:

2-(2,6-Dimethylphenoxy)aniline, with the CAS number 38629-93-5, is an organic compound characterized by its aromatic structure, which includes both an aniline and a phenoxy group. This compound features a dimethyl-substituted phenyl ring, contributing to its hydrophobic properties and potential for various interactions in chemical reactions. It typically appears as a solid or viscous liquid, depending on its purity and environmental conditions. The presence of the amino group (-NH2) in the aniline portion allows for hydrogen bonding, which can influence its solubility in polar solvents. Additionally, the phenoxy group can enhance the compound's reactivity, making it useful in various applications, including as an intermediate in organic synthesis or in the production of dyes and pharmaceuticals. Safety data should be consulted for handling, as compounds of this nature may pose health risks if ingested or inhaled. Overall, 2-(2,6-dimethylphenoxy)aniline is a versatile compound with significant implications in chemical research and industrial applications.

Formula: C₁₄H₁₅NO

InChI: InChI=1/C14H15NO/c1-10-6-5-7-11(2)14(10)16-13-9-4-3-8-12(13)15/h3-9H,15H2,1-2H3

SMILES: Cc1cccc(C)c1Oc1ccccc1N

2-(2,6-Dimethylphenoxy)aniline

CAS: 38629-93-5

Versatile small molecule scaffold

Formula: C₁₄H₁₅NO

Purity: Min. 95%

Molecular weight: 213.27 g/mol

Ref: 3D-NBA62993