CymitQuimica logo

CAS 3864-18-4

:

2,3-dimethylbiphenyl

Description:
2,3-Dimethylbiphenyl is an organic compound classified as a biphenyl derivative, characterized by the presence of two methyl groups attached to the biphenyl structure. Its molecular formula is C14H12, indicating it consists of 14 carbon atoms and 12 hydrogen atoms. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a relatively high melting point and boiling point compared to simpler hydrocarbons, reflecting its larger molecular structure. 2,3-Dimethylbiphenyl is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. It is often used in organic synthesis and as a solvent in various chemical reactions. Additionally, due to its structural characteristics, it may exhibit interesting electronic properties and potential applications in materials science. Safety data indicates that, like many organic compounds, it should be handled with care to avoid inhalation or skin contact, as it may pose health risks.
Formula:C14H14
InChI:InChI=1/C14H14/c1-11-7-6-10-14(12(11)2)13-8-4-3-5-9-13/h3-10H,1-2H3
SMILES:Cc1cccc(c1C)c1ccccc1
Synonyms:
  • 1,1'-Biphenyl, 2,3-Dimethyl-
  • 2,3-Dimethylbiphenyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.