CAS 38659-86-8

N-[4-(dimethylamino)phenyl]-3-oxobutanamide

Description:

N-[4-(Dimethylamino)phenyl]-3-oxobutanamide, also known by its CAS number 38659-86-8, is an organic compound characterized by its amide functional group and a ketone moiety. This compound features a dimethylamino group attached to a phenyl ring, which contributes to its potential as a dye or pigment due to the electron-donating nature of the dimethylamino substituent. The presence of the 3-oxobutanamide structure indicates that it has both carbonyl and amine functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in different fields. Overall, N-[4-(dimethylamino)phenyl]-3-oxobutanamide is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1/C12H16N2O2/c1-9(15)8-12(16)13-10-4-6-11(7-5-10)14(2)3/h4-7H,8H2,1-3H3,(H,13,16)

SMILES: CC(=O)CC(=O)Nc1ccc(cc1)N(C)C

N-[4-(dimethylamino)phenyl]-3-oxobutanamide

CAS: 38659-86-8

Formula: C₁₂H₁₆N₂O₂

Purity: 95.0%

Molecular weight: 220.272

Ref: 10-F314803