CAS 386704-15-0
:methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate
Description:
Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate, with the CAS number 386704-15-0, is an organic compound characterized by its complex structure that includes a pyridine ring and a trifluoromethyl group. This compound features a ketone functional group and an ester moiety, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the trifluoromethyl group enhances lipophilicity and can influence biological activity, making it of interest in drug development. Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate is typically a solid or liquid at room temperature, depending on its purity and specific formulation. Its properties, such as solubility and stability, can vary based on environmental conditions and the presence of other chemical species. As with many fluorinated compounds, it may exhibit unique electronic properties, making it valuable in various chemical reactions and applications, including agrochemicals and pharmaceuticals. Proper handling and safety measures are essential due to the potential toxicity associated with fluorinated compounds.
Formula:C10H8F3NO3
InChI:InChI=1/C10H8F3NO3/c1-17-9(16)4-7(15)6-2-3-8(14-5-6)10(11,12)13/h2-3,5H,4H2,1H3
SMILES:COC(=O)CC(=O)c1ccc(C(F)(F)F)nc1
Synonyms:- 3-Pyridinepropanoic acid, beta-oxo-6-(trifluoromethyl)-, methyl ester
- Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate
- Methyl 3-oxo-3-(6-(tri?uoromethyl)pyrid in-3-yl)propanoate
- Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate 97%
- Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propionate, Methyl [6-(trifluoromethyl)nicotinoyl]acetate
- 11β-HSD1-IN-8
- 3-Pyridinepropanoic acid, β-oxo-6-(trifluoromethyl)-, methyl ester
- 3-oxo-3-[6-(trifluoromethyl)-3-pyridinyl]propanoic acid methyl ester
- Methyl3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 6-(trifluoromethyl)nicotinoylacetate
CAS:Formula:C10H8F3NO3Purity:95%Color and Shape:SolidMolecular weight:247.1706Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoate
CAS:Methyl 3-oxo-3-[6-(trifluoromethyl)pyridin-3-yl]propanoatePurity:95%Color and Shape:Pale Yellow SolidMolecular weight:247.17g/molMethyl 6-(trifluoromethyl)nicotinyl acetate
CAS:Formula:C10H8F3NO3Purity:95%Color and Shape:SolidMolecular weight:247.17311β-HSD1-IN-8
CAS:11β-HSD1-IN-8 is a useful organic compound for research related to life sciences. The catalog number is T65743 and the CAS number is 386704-15-0.Formula:C10H8F3NO3Color and Shape:SolidMolecular weight:247.173



