CymitQuimica logo

CAS 386715-33-9

:

5-(Chloromethyl)-2-(trifluoromethyl)pyridine

Description:
5-(Chloromethyl)-2-(trifluoromethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloromethyl group at the 5-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits polar characteristics due to the electronegative chlorine and fluorine atoms, which can enhance its solubility in polar solvents. The trifluoromethyl group imparts unique electronic properties, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on further studies. Safety precautions should be taken when handling this substance, as it may pose health risks due to its reactive functional groups.
Formula:C7H5ClF3N
InChI:InChI=1S/C7H5ClF3N/c8-3-5-1-2-6(12-4-5)7(9,10)11/h1-2,4H,3H2
InChI key:InChIKey=PRPAYPBERKUDKO-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(CCl)C=N1
Synonyms:
  • (6-Trifluoromethylpyridin-3-yl)methyl chloride
  • 3-Chloromethyl-6-(trifluoromethyl)pyridine
  • 5-(Chloromethyl)-2-(trifluoromethyl)pyridine
  • Pyridine, 5-(chloromethyl)-2-(trifluoromethyl)-
Found 4 products.