CymitQuimica logo

CAS 386715-35-1

:

6-(Trifluoromethyl)-3-pyridinecarboxamide

Description:
6-(Trifluoromethyl)-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. The carboxamide functional group (-C(=O)NH2) at the 3-position contributes to its polar characteristics, making it soluble in polar solvents. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties and ability to interact with biological targets. Its molecular structure allows for various chemical reactions, including substitution and coupling, which can be exploited in synthetic chemistry. Additionally, the trifluoromethyl group is known to impart metabolic stability and can modulate the compound's interaction with enzymes and receptors. Overall, 6-(Trifluoromethyl)-3-pyridinecarboxamide is a versatile compound with significant implications in medicinal chemistry and material science.
Formula:C7H5F3N2O
InChI:InChI=1S/C7H5F3N2O/c8-7(9,10)5-2-1-4(3-12-5)6(11)13/h1-3H,(H2,11,13)
InChI key:InChIKey=RIKJKWNZUSPCCM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(C(N)=O)C=N1
Synonyms:
  • 3-Pyridinecarboxamide, 6-(trifluoromethyl)-
  • 6-(Trifluoromethyl)-3-pyridinecarboxamide
  • Copper(1+) Trifluoromethanethiolate
Found 4 products.