CAS 38675-79-5
:Cyclopropyl[4-(1,1-dimethylethyl)phenyl]methanone
Description:
Cyclopropyl[4-(1,1-dimethylethyl)phenyl]methanone, with the CAS number 38675-79-5, is an organic compound characterized by its unique structure that includes a cyclopropyl group and a ketone functional group. This compound features a phenyl ring substituted with a tert-butyl group, which contributes to its steric bulk and influences its reactivity and stability. The presence of the cyclopropyl moiety introduces ring strain, which can affect the compound's chemical behavior, making it potentially reactive under certain conditions. Cyclopropyl groups are known for their ability to participate in various chemical reactions, including ring-opening and rearrangements. The ketone functional group indicates that the compound can undergo typical carbonyl reactions, such as nucleophilic addition. Overall, the combination of these structural features suggests that Cyclopropyl[4-(1,1-dimethylethyl)phenyl]methanone may exhibit interesting properties and reactivity patterns, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-14(2,3)12-8-6-11(7-9-12)13(15)10-4-5-10/h6-10H,4-5H2,1-3H3
InChI key:InChIKey=XVDLXILLBPXUPJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C(C)(C)C)C=C1)C2CC2
Synonyms:- (4-Tert-Butylphenyl)(Cyclopropyl)Methanone
- (4-tert-Butylphenyl)-cyclopropylmethanone
- Cyclopropyl[4-(1,1-dimethylethyl)phenyl]methanone
- Ketone, p-tert-butylphenyl cyclopropyl
- Methanone, cyclopropyl[4-(1,1-dimethylethyl)phenyl]-
- NSC 163106
- p-tert-Butylphenyl cyclopropyl ketone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
