CAS 3868-61-9
:Endosulfan lactone
Description:
Endosulfan lactone, with the CAS number 3868-61-9, is a chemical compound that is a derivative of endosulfan, a pesticide known for its insecticidal properties. It is characterized by its cyclic structure, which includes a lactone functional group. This compound is typically a white to pale yellow solid and is relatively stable under normal conditions. Endosulfan lactone exhibits moderate solubility in organic solvents but is less soluble in water, which influences its environmental behavior and bioavailability. It is known to have a range of biological activities, including insecticidal and acaricidal effects, making it relevant in agricultural applications. However, due to its potential toxicity and environmental persistence, its use is subject to regulatory scrutiny in many regions. The compound's mode of action primarily involves interference with the nervous system of target organisms, leading to paralysis and death. As with many pesticides, safety precautions are essential when handling endosulfan lactone to mitigate risks to human health and the environment.
Formula:C9H4Cl6O2
InChI:InChI=1/C9H4Cl6O2/c10-4-5(11)8(13)3-2(1-17-6(3)16)7(4,12)9(8,14)15/h2-3H,1H2
InChI key:InChIKey=GIUKJJMBQBRFTN-UHFFFAOYSA-N
SMILES:ClC12C3C(C(Cl)(C1(Cl)Cl)C(Cl)=C2Cl)COC3=O
Synonyms:- 1,7,8,9,10,10-Hexachloro-4-oxatricyclo[5.2.1.0~2,6~]dec-8-en-3-one
- 4,5,6,7,8,8-Hexachloro-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1(3H)-one
- 4,5,6,7,8,8-Hexachloro-4,7-methano 1,3,3a,4,7,7a-hexahydroisobenzofuran-1-one
- 4,7-methanoisobenzofuran-1(3H)-one, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro-
- 5-Norbornene-2-carboxylic acid, 1,4,5,6,7,7-hexachloro-3-(hydroxymethyl)-, γ-lactone
- Endolactone
- Endosulfan lactone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
