CAS 38695-71-5

methyl 4-phenylthiophene-3-carboxylate

Description:

Methyl 4-phenylthiophene-3-carboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a phenyl group and a carboxylate ester functional group. This compound typically exhibits a yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic nature. The presence of the thiophene ring contributes to its potential electronic properties, making it of interest in organic electronics and materials science. Methyl 4-phenylthiophene-3-carboxylate may also exhibit interesting reactivity due to the carboxylate group, allowing for various chemical transformations. Its applications can extend to fields such as pharmaceuticals, agrochemicals, and organic synthesis, where it may serve as an intermediate or building block for more complex molecules. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₂H₁₀O₂S

InChI: InChI=1/C12H10O2S/c1-14-12(13)11-8-15-7-10(11)9-5-3-2-4-6-9/h2-8H,1H3

SMILES: COC(=O)c1cscc1c1ccccc1

Synonyms:

• METHYL 4-PHENYLTHIOPHENE-3-CARBOXYLATE
• Methyl 4-phenylthiophene-3-carboxylate 97%

Methyl 4-phenylthiophene-3-carboxylate

CAS: 38695-71-5

Methyl 4-phenylthiophene-3-carboxylate

Purity: 97%

Molecular weight: 218.27g/mol

Ref: 54-OR11374

Methyl 4-phenylthiophene-3-carboxylate

CAS: 38695-71-5

Purity: 98%

Molecular weight: 218.04

Ref: 10-F553967