CymitQuimica logo

CAS 38696-20-7

:

5-Bromo-2-phenylpyrimidine

Description:
5-Bromo-2-phenylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the 5-position and a phenyl group at the 2-position. This compound typically appears as a solid and is known for its role in various chemical reactions, particularly in medicinal chemistry and organic synthesis. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. The phenyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, 5-Bromo-2-phenylpyrimidine may exhibit biological activity, which can be explored in drug development. Its molecular structure allows for potential interactions with various biological targets, making it a compound of interest in research. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C10H7BrN2
InChI:InChI=1S/C10H7BrN2/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-7H
InChI key:ZZKCBZDJCZZPSM-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC=C(C=N2)Br
Found 4 products.