CAS 387-43-9
:4-fluoroindole
Description:
4-Fluoroindole is a chemical compound characterized by the presence of a fluorine atom at the 4-position of the indole ring system. Indole itself is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The introduction of the fluorine atom can influence the compound's electronic properties, reactivity, and biological activity. 4-Fluoroindole is typically a white to off-white solid and is soluble in organic solvents. It is of interest in medicinal chemistry and materials science due to its potential applications in pharmaceuticals, particularly as a building block for the synthesis of various bioactive compounds. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable modification in drug design. Additionally, 4-fluoroindole can participate in various chemical reactions, including electrophilic substitutions and coupling reactions, which are useful in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H6FN
InChI:InChI=1/C8H6FN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H
SMILES:c1cc2cc[nH]c2c(c1)F
Synonyms:- 1H-Indole, 4-fluoro-
- 4-fluoro-1H-indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Fluoroindole
CAS:Formula:C8H6FNPurity:>98.0%(GC)Color and Shape:White or colorless to Brown powder to lump to clear liquidMolecular weight:135.14Ref: IN-DA0037XJ
1g24.00€5g47.00€10g61.00€1kgTo inquire25g121.00€5kgTo inquire100g272.00€500gTo inquire4-Fluoro-1H-indole
CAS:4-Fluoro-1H-indoleFormula:C8H6FNPurity:≥95%Color and Shape: clear. very dark brown liquid/dark brown low-melting solid fused solidMolecular weight:135.14g/mol4-Fluoroindole
CAS:4-Fluoroindole is a compound that belongs to the class of 5-methoxyindoles, which are used as drugs in plant physiology. The analog of 4-fluoroindole is important for cell culture and transcriptomic analysis. It has been shown to reduce the growth of cryptococcus neoformans by inhibiting its ability to produce acid. 4-Fluoroindole also inhibits the growth of other opportunistic fungi, such as Aspergillus niger. This drug is addictive and can be toxic if it enters the environment. 4-Fluoroindole also inhibits the growth of plants when applied as a pesticide.Formula:C8H6FNColor and Shape:PowderMolecular weight:135.14 g/mol4-Fluoroindole
CAS:Formula:C8H6FNPurity:96%Color and Shape:Solid, Low Melting SolidMolecular weight:135.141





