CAS 38701-74-5: 2-Propan-2-d-ol-d, 1,1,1,3,3,3-hexafluoro-
Description:2-Propan-2-d-ol-d, 1,1,1,3,3,3-hexafluoro- is a fluorinated alcohol characterized by its unique structure, which includes a propanol backbone with deuterium substitution and multiple fluorine atoms. This compound is notable for its high degree of fluorination, which imparts distinct physical and chemical properties, such as increased hydrophobicity and thermal stability. The presence of deuterium, a stable isotope of hydrogen, can also influence the compound's reactivity and isotopic labeling in various chemical reactions. Typically, fluorinated alcohols exhibit lower volatility and higher boiling points compared to their non-fluorinated counterparts. This substance may find applications in specialized fields such as pharmaceuticals, materials science, and as a solvent in chemical synthesis. Its unique characteristics make it a subject of interest in research focused on developing new materials and understanding the behavior of fluorinated compounds in various environments. Safety and handling precautions are essential due to the potential hazards associated with fluorinated chemicals.
Formula:C3D2F6O
InChI:InChI=1S/C3H2F6O/c4-2(5,6)1(10)3(7,8)9/h1,10H/i1D,10D
InChI key:InChIKey=BYEAHWXPCBROCE-AWPANEGFSA-N
SMILES:FC(F)(F)C(O)C(F)(F)F
- Synonyms:
- 1,1,1,3,3,3-Hexafluoropropan-2-Ol
- 1,1,1,3,3,3-hexafluoro(~2~H)propan-2-(~2~H)ol
- 2-Propan-2-d-ol-d, 1,1,1,3,3,3-hexafluoro-
- HFIP-d<sub>2</sub>
- 1,1,1,3,3,3-Hexafluoro(2-2H)propan-2-(2H)ol
- HFIP-d2
