CAS 387358-54-5: 5-(3,4-Difluorophenyl)isoxazole

Description: 5-(3,4-Difluorophenyl)isoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of the 3,4-difluorophenyl group indicates that the compound has two fluorine substituents on a phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. This compound is typically used in medicinal chemistry and may exhibit biological activity, making it of interest in drug development. Its molecular structure contributes to its potential interactions with biological targets. The CAS number 387358-54-5 uniquely identifies this compound in chemical databases, facilitating its study and application in various fields, including pharmaceuticals and materials science. The fluorine atoms can enhance the compound's metabolic stability and lipophilicity, which are important factors in drug design. Overall, 5-(3,4-Difluorophenyl)isoxazole is a compound of interest due to its unique structural features and potential applications in various chemical and biological contexts.

Formula: C₉H₅F₂NO

InChI: InChI=1S/C9H5F2NO/c10-7-2-1-6(5-8(7)11)9-3-4-12-13-9/h1-5H

InChI key: InChIKey=SAHZBEXDVFZMLO-UHFFFAOYSA-N

SMILES: FC=1C=CC(=CC1F)C=2ON=CC2

5-(3,4-Difluorophenyl)isoxazole

CAS: 387358-54-5

• Molecular weight: 181.14g/mol

5-(3,4-Difluorophenyl)isoxazole

CAS: 387358-54-5

• Purity: 98%
• Molecular weight: 181.14199829101562

5-(3,4-Difluorophenyl)isoxazole

CAS: 387358-54-5

Versatile small molecule scaffold

• Formula: C₉H₅F₂NO
• Purity: Min. 95%
• Molecular weight: 181.14 g/mol