CAS 38736-15-1

2-(4-Fluorophenyl)-5-(2-naphthalenyl)-1,3,4-oxadiazole

Description:

2-(4-Fluorophenyl)-5-(2-naphthalenyl)-1,3,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a fluorophenyl group and a naphthalenyl group, contributing to its unique electronic and optical properties. The presence of the fluorine atom enhances the compound's electron-withdrawing characteristics, potentially influencing its reactivity and stability. Oxadiazoles are known for their applications in materials science, particularly in the development of luminescent materials, organic semiconductors, and pharmaceuticals. The compound's structure suggests potential for interesting photophysical properties, making it a candidate for use in organic light-emitting diodes (OLEDs) and other optoelectronic devices. Additionally, the presence of aromatic systems may contribute to its stability and solubility in organic solvents. Overall, 2-(4-Fluorophenyl)-5-(2-naphthalenyl)-1,3,4-oxadiazole represents a versatile compound with potential applications in various fields of chemistry and materials science.

Formula: C₁₈H₁₁FN₂O

InChI: InChI=1S/C18H11FN2O/c19-16-9-7-13(8-10-16)17-20-21-18(22-17)15-6-5-12-3-1-2-4-14(12)11-15/h1-11H

InChI key: InChIKey=BFFQFOBHPRLZCN-UHFFFAOYSA-N

SMILES: FC1=CC=C(C=2OC(=NN2)C3=CC4=C(C=C3)C=CC=C4)C=C1

Synonyms:

• 1,3,4-Oxadiazole, 2-(4-fluorophenyl)-5-(2-naphthalenyl)-
• 2-(4-Fluorophenyl)-5-(2-naphthalenyl)-1,3,4-oxadiazole
• 2-(4-Fluorophenyl)-5-(2-naphthyl)oxadiazole
• 2-(4-Fluorophenyl)-5-(Naphthalen-2-Yl)-1,3,4-Oxadiazole
• NSC 90374

2-(4-Fluorophenyl)-5-(2-naphthyl)-1,3,4-oxadiazole

CAS: 38736-15-1

2-(4-Fluorophenyl)-5-(2-naphthyl)-1,3,4-oxadiazole is a clinical drug that is used to diagnose the presence of cholesterol in human serum. It reacts with cholesterol esterase to form a fluorescent product. The fluorescence intensity of this reaction product can then be measured and used to determine the concentration of cholesterol in the sample. 2-(4-Fluorophenyl)-5-(2-naphthyl)-1,3,4-oxadiazole has been shown to have a high specificity for cholesterol esterase and does not react with enzymes such as carboxylesterases and cholesteryl esterases. This compound also inhibits uptake into cells by acting on an uptake carrier protein, which prevents it from entering cells.

Formula: C₁₈H₁₁FN₂O

Purity: Min. 95%

Molecular weight: 290.3 g/mol

Ref: 3D-FF67263