CAS 38736-23-1

3-hydrazinyl-6-methyl-1,2,4-triazin-5(2H)-one

Description:

3-Hydrazinyl-6-methyl-1,2,4-triazin-5(2H)-one is a heterocyclic organic compound characterized by its triazine ring structure, which contains nitrogen atoms that contribute to its unique chemical properties. This compound features a hydrazine functional group, which is known for its reactivity and ability to form various derivatives. The presence of a methyl group at the 6-position of the triazine ring influences its solubility and reactivity, making it potentially useful in various chemical applications, including as a building block in pharmaceuticals or agrochemicals. The compound's structure suggests it may exhibit biological activity, although specific biological properties would require further investigation. Additionally, the presence of multiple nitrogen atoms in the triazine ring can impart stability and influence the compound's interaction with other chemical species. Overall, 3-hydrazinyl-6-methyl-1,2,4-triazin-5(2H)-one is a compound of interest in the field of organic chemistry, particularly for its potential applications in medicinal chemistry and material science.

Formula: C₄H₇N₅O

InChI: InChI=1/C4H7N5O/c1-2-3(10)6-4(7-5)9-8-2/h5H2,1H3,(H2,6,7,9,10)

SMILES: Cc1c(nc(NN)nn1)O

Synonyms:

• 1,2,4-triazin-5(4H)-one, 3-hydrazinyl-6-methyl-
• 1,2,4-Triazin-5-Ol, 3-Hydrazinyl-6-Methyl-
• 3-Hydrazino-6-methyl-1,2,4-triazin-5(4H)-one
• 3-Hydrazino-6-Methyl-1,2,4-Triazin-5-Ol
• 3-Hydrazino-6-methyl-4H-[1,2,4]triazin-5-one

3-hydrazino-6-methyl-1,2,4-triazin-5-ol

CAS: 38736-23-1

3-hydrazino-6-methyl-1,2,4-triazin-5-ol

Purity: ≥95%

Ref: 54-OR29629

3-hydrazino-6-methyl-1,2,4-triazin-5(4H)-one

CAS: 38736-23-1

Formula: C₄H₇N₅O

Purity: 95.0%

Molecular weight: 141.134

Ref: 10-F308355

3-Hydrazinyl-6-methyl-4H-1,2,4-triazin-5-one

CAS: 38736-23-1

3-Hydrazinyl-6-methyl-4H-1,2,4-triazin-5-one is a chemical compound that belongs to the group of aromatic aldehydes. It has been shown to react with elemental chlorine, forming 3-chloro-6-methyl-4H-[1,2,4]triazin-5(3H)-one. This reaction can be accomplished by photolysis or pyrolysis. The magnetic properties of this compound allow for its use in studies involving electron spin resonance spectroscopy and nuclear magnetic resonance spectroscopy. 3-Hydrazinyl-6-methyl-[1,2,4]triazin-[5-(3H)]one can also undergo a photochemical reaction when exposed to ultraviolet radiation with molecular oxygen. The mechanism of this reaction is not fully understood but it is thought to involve electron transfer from the excited state of the 3 hydrazine molecule to an oxygen molecule followed by

Formula: C₄H₇N₅O

Purity: Min. 95%

Molecular weight: 141.13 g/mol

Ref: 3D-NBA73623