CAS 38754-71-1
:(-)-Corey Lactone aldehyde P-Phenyl Benzoate
Description:
(-)-Corey Lactone aldehyde P-Phenyl Benzoate, with the CAS number 38754-71-1, is a chemical compound that belongs to the class of lactones and esters. It is characterized by its unique structural features, which include a lactone ring and a phenyl benzoate moiety. This compound is typically used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its stereochemistry is significant, as the (-)-enantiomer can exhibit distinct biological activities compared to its counterparts. The compound is generally soluble in organic solvents, which makes it suitable for various chemical reactions. Additionally, it may possess specific functional properties, such as reactivity towards nucleophiles due to the presence of the aldehyde group. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use. Overall, (-)-Corey Lactone aldehyde P-Phenyl Benzoate is a valuable compound in synthetic organic chemistry.
Formula:C21H18O5
InChI:InChI=1/C21H18O5/c22-12-17-16-10-20(23)25-18(16)11-19(17)26-21(24)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12,16-19H,10-11H2/t16-,17-,18+,19-/m1/s1
Synonyms:- (3aR,4R,5R,6aS)-4-formyl-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl biphenyl-4-carboxylate
- [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
[(3aR,4R,5R,6aS)-4-Formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-Phenylbenzoate
CAS:Color and Shape:Neat(3aR,4R,5R,6aS)-4-Formyl-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl [1,1'-biphenyl]-4-carboxylate
CAS:Controlled ProductApplications (3aR,4R,5R,6aS)-4-Formyl-2-oxohexahydro-2H-cyclopenta[b]furan-5-yl [1,1'-biphenyl]-4-carboxylate is an intermediate in the synthesis of Prostaglandin E2 (P838610), the most common and biologically potent of mammalian prostaglandins.
References Radeuchel, B., et al.: Tetrahedron. Lett., 633, 9 (1975);Formula:C21H18O5Color and Shape:NeatMolecular weight:350.3646

