CAS 38789-75-2

methyl 5-methoxypyrazine-2-carboxylate

Description:

Methyl 5-methoxypyrazine-2-carboxylate is an organic compound characterized by its pyrazine ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methoxy group (-OCH3) and a carboxylate group (-COO-) attached to the pyrazine ring, contributing to its chemical reactivity and potential applications. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with green, herbaceous, or earthy notes, making it of interest in flavor and fragrance industries. The presence of the methoxy group enhances its solubility in organic solvents, while the carboxylate moiety can participate in various chemical reactions, such as esterification and nucleophilic substitutions. Methyl 5-methoxypyrazine-2-carboxylate is also studied for its potential biological activities, including antimicrobial properties. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if ingested or inhaled.

Formula: C₇H₈N₂O₃

InChI: InChI=1/C7H8N2O3/c1-11-6-4-8-5(3-9-6)7(10)12-2/h3-4H,1-2H3

SMILES: COc1cnc(cn1)C(=O)OC

Synonyms:

• 2-Pyrazinecarboxylic Acid, 5-Methoxy-, Methyl Ester

5-METHOXYPYRAZINECARBOXYLIC ACID METHYL ESTER

CAS: 38789-75-2

Formula: C₇H₈N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1500

Ref: IN-DA00C6K3

5-methoxy-2-Pyrazinecarboxylic acid methyl ester

CAS: 38789-75-2

5-methoxy-2-Pyrazinecarboxylic acid methyl ester

Purity: 97%

Molecular weight: 168.152g/mol

Ref: 54-OR73551

Methyl 5-methoxypyrazine-2-carboxylate

CAS: 38789-75-2

Formula: C₇H₈N₂O₃

Purity: 97%

Color and Shape: Solid, Yellow crystalline powder

Molecular weight: 168.152

Ref: 10-F321156

Methyl 5-Methoxypyrazinecarboxylate

CAS: 38789-75-2

Methyl 5-methoxypyrazinecarboxylate is an organic compound that belongs to the group of triazoles. It has been used as a pesticide for the control of plant pathogenic fungi, nematodes and insects, such as dextrose, chloride, oxadiazoles and agriculturally. This product is effective against pests at low doses. Methyl 5-methoxypyrazinecarboxylate inhibits the synthesis of proteins in plants by inhibiting chitin synthase enzymes in fungi and nematodes. It also inhibits the synthesis of proteins in insects by interfering with the synthesis of proteins involved in cell division.

Formula: C₇H₈N₂O₃

Purity: Min. 95%

Molecular weight: 168.15 g/mol

Ref: 3D-NBA78975