CymitQuimica logo

CAS 3879-08-1

:

4-Hydroxybutyric acid hydrazide

Description:
4-Hydroxybutyric acid hydrazide, with the CAS number 3879-08-1, is an organic compound characterized by the presence of both a hydrazide functional group and a hydroxybutyric acid moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its hydrophilic nature. It is known for its potential applications in pharmaceuticals and biochemistry, particularly in the synthesis of various derivatives and as a building block in drug development. The hydrazide functional group can participate in various chemical reactions, including condensation and hydrazone formation, making it a versatile intermediate in organic synthesis. Additionally, 4-Hydroxybutyric acid hydrazide may exhibit biological activity, which warrants further investigation into its pharmacological properties. As with many chemical substances, proper handling and safety precautions should be observed, as it may pose health risks if ingested or improperly managed.
Formula:C4H10N2O2
InChI:InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8)
InChI key:WOXQFPPKZBOSTN-UHFFFAOYSA-N
SMILES:C(CC(=NN)O)CO
Synonyms:
  • 4-Hydroxybutanoic hydrazide
  • 4-Hydroxybutanehydrazide
Found 4 products.