CymitQuimica logo

CAS 38792-88-0

:

4-(2-methylpropyl)cyclohexanecarboxylic acid

Description:
4-(2-Methylpropyl)cyclohexanecarboxylic acid, with the CAS number 38792-88-0, is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a branched alkyl group. This compound typically exhibits properties common to carboxylic acids, such as being polar and capable of forming hydrogen bonds, which influences its solubility in polar solvents like water. The presence of the bulky 2-methylpropyl group can affect its steric hindrance and reactivity, potentially leading to unique chemical behavior compared to simpler carboxylic acids. It may also participate in various chemical reactions, including esterification and decarboxylation, depending on the reaction conditions. Additionally, the compound's physical properties, such as melting and boiling points, are influenced by its molecular structure and the interactions between its functional groups. Overall, 4-(2-methylpropyl)cyclohexanecarboxylic acid is of interest in organic synthesis and may have applications in pharmaceuticals or materials science.
Formula:C11H20O2
InChI:InChI=1/C11H20O2/c1-8(2)7-9-3-5-10(6-4-9)11(12)13/h8-10H,3-7H2,1-2H3,(H,12,13)
InChI key:NFJJRCCYQXONBL-UHFFFAOYSA-N
SMILES:CC(C)CC1CCC(CC1)C(=O)O
Found 4 products.