CAS 38792-95-9

4-octylcyclohexanecarboxylic acid

Description:

4-Octylcyclohexanecarboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with an octyl group and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It possesses a relatively high molecular weight due to the presence of the octyl chain, which contributes to its hydrophobic characteristics. The carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. Its structure suggests potential applications in the synthesis of surfactants, lubricants, or as an intermediate in organic synthesis. Additionally, the presence of the cyclohexane ring may influence its physical properties, such as boiling point and solubility, making it less soluble in water but more compatible with non-polar solvents. Overall, 4-octylcyclohexanecarboxylic acid is a versatile compound with potential utility in various chemical and industrial applications.

Formula: C₁₅H₂₈O₂

InChI: InChI=1/C15H28O2/c1-2-3-4-5-6-7-8-13-9-11-14(12-10-13)15(16)17/h13-14H,2-12H2,1H3,(H,16,17)

4-Octylcyclohexane-1-carboxylic acid

CAS: 38792-95-9

Versatile small molecule scaffold

Formula: C₁₅H₂₈O₂

Purity: Min. 95%

Molecular weight: 240.38 g/mol

Ref: 3D-NBA79295