CymitQuimica logo

CAS 388-11-4

:

N-(3,4,6-trifluoro-2-nitrophenyl)acetamide

Description:
N-(3,4,6-trifluoro-2-nitrophenyl)acetamide, with the CAS number 388-11-4, is an organic compound characterized by its acetamide functional group attached to a trifluorinated nitrophenyl moiety. This compound features a phenyl ring that is substituted with three fluorine atoms and a nitro group, which significantly influences its chemical properties, including increased electronegativity and potential reactivity. The presence of the trifluoromethyl groups enhances its lipophilicity and stability, making it useful in various applications, including pharmaceuticals and agrochemicals. The nitro group contributes to its potential as a reactive intermediate in organic synthesis. Additionally, the compound may exhibit interesting biological activities due to its unique structure, making it a subject of interest in medicinal chemistry. As with many fluorinated compounds, it may also possess distinct physical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and fluorinated compounds.
Formula:C8H5F3N2O3
InChI:InChI=1/C8H5F3N2O3/c1-3(14)12-7-5(10)2-4(9)6(11)8(7)13(15)16/h2H,1H3,(H,12,14)
SMILES:CC(=Nc1c(cc(c(c1N(=O)=O)F)F)F)O
Synonyms:
  • acetamide, N-(3,4,6-trifluoro-2-nitrophenyl)-
  • N-(3,4,6-Trifluoro-2-nitrophenyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.