CAS 3880-76-0

8-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride (1:1)

Description:

8-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride, with the CAS number 3880-76-0, is a chemical compound characterized by its structural features, which include a methoxy group and a tetrahydronaphthalene framework. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the amine functional group suggests potential basicity and reactivity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure may contribute to specific biological activities, potentially influencing neurotransmitter systems or other physiological pathways. The compound's characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information, ensuring proper safety protocols are followed in laboratory or industrial settings.

Formula: C₁₁H₁₆ClNO

InChI: InChI=1/C11H15NO.ClH/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11;/h2-4,9H,5-7,12H2,1H3;1H

SMILES: COc1cccc2CCC(Cc12)N.Cl

5-HT1A modulator 2 hydrochloride

CAS: 3880-76-0

5-HT1A modulator 2 hydrochloride is a modulator of 5-HT1A showing an affinity of 53 nM for 5-HT1A binding.

Formula: C₁₁H₁₆ClNO

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 213.7

Ref: TM-T37197

8-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride

Controlled Product

CAS: 3880-76-0

Please enquire for more information about 8-Methoxy-1,2,3,4-tetrahydronaphthalen-2-amine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₆ClNO

Purity: Min. 95%

Molecular weight: 213.7 g/mol

Ref: 3D-DAA88076