CAS 38800-20-3
:Diphenylthienyltetrazoliumchloride; 90%
Description:
Diphenylthienyltetrazolium chloride (DPTT) is a chemical compound commonly used as a redox indicator and in various biochemical assays. It is characterized by its ability to undergo reduction, leading to a color change that can be quantitatively measured, making it useful in cell viability assays and metabolic activity studies. The compound typically appears as a crystalline solid and is soluble in polar solvents. DPTT is known for its stability under standard laboratory conditions, although it should be stored away from light to prevent degradation. The presence of the tetrazolium ring is crucial for its function, as it is reduced by viable cells to form a colored formazan product, which can be detected spectrophotometrically. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, DPTT serves as a valuable tool in research and clinical laboratories for assessing cellular health and metabolic activity.
Formula:C17H13ClN4S
InChI:InChI=1/C17H13N4S.ClH/c1-3-8-14(9-4-1)20-18-17(16-12-7-13-22-16)19-21(20)15-10-5-2-6-11-15;/h1-13H;1H/q+1;/p-1
Synonyms:- 2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride
- 2,3-diphenyl-5-(thiophen-2-yl)-2H-tetrazol-3-ium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3-Diphenyl-5-(2-thienyl)tetrazolium Chloride
CAS:Formula:C17H13ClN4SPurity:>97.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:340.832,3-Diphenyl-5-(2-thienyl)tetrazolium chloride
CAS:Formula:C17H13ClN4SPurity:97%Molecular weight:340.82992,3-Diphenyl-5-(2-thienyl)tetrazolium Chloride
CAS:2,3-Diphenyl-5-(2-thienyl)tetrazolium ChloridePurity:>97.0%2,3-Diphenyl-5-(2-thienyl)tetrazolium chloride
CAS:Formula:C17H13ClN4SPurity:(HPLC) ≥ 97.0%Color and Shape:White to light yellow crystalline powderMolecular weight:340.832,3-Diphenyl-5-(thiophen-2-yl)-2H-tetrazol-3-ium chloride
CAS:Purity:98%Molecular weight:340.8299865722656





