CAS 388082-81-3

N-{3-chloro-4-[(3-fluorobenzyl)oxy]phenyl}-6-[2-({[2-(methylsulfonyl)ethyl]amino}methyl)-1,3-thiazol-4-yl]quinazolin-4-amine dihydrochloride

Description:

N-{3-chloro-4-[(3-fluorobenzyl)oxy]phenyl}-6-[2-({[2-(methylsulfonyl)ethyl]amino}methyl)-1,3-thiazol-4-yl]quinazolin-4-amine dihydrochloride, with CAS number 388082-81-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazoline core, a thiazole moiety, and various functional groups such as a chloro group, a fluorobenzyl ether, and a methylsulfonyl group. This compound is typically studied for its potential pharmacological properties, particularly in the context of targeted therapies in oncology or other therapeutic areas. Its dihydrochloride salt form indicates that it is likely soluble in water, which is a common characteristic for many pharmaceutical compounds, facilitating its bioavailability. The presence of multiple heteroatoms (such as sulfur and nitrogen) and halogens suggests that it may exhibit diverse interactions with biological targets. As with many complex organic molecules, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species.

Formula: C₂₈H₂₇Cl₃FN₅O₃S₂

InChI: InChI=1/C28H25ClFN5O3S2.2ClH/c1-40(36,37)10-9-31-14-27-35-25(16-39-27)19-5-7-24-22(12-19)28(33-17-32-24)34-21-6-8-26(23(29)13-21)38-15-18-3-2-4-20(30)11-18;;/h2-8,11-13,16-17,31H,9-10,14-15H2,1H3,(H,32,33,34);2*1H

SMILES: CS(=O)(=O)CCNCc1nc(cs1)c1ccc2c(c1)c(ncn2)Nc1ccc(c(c1)Cl)OCc1cccc(c1)F.Cl.Cl

GW 583340

CAS: 388082-81-3

GW 583340

Purity: ≥98%

Molecular weight: 598.11g/mol

Ref: 54-BUP20978

GW 583340

CAS: 388082-81-3

GW 583340 is a potent and selective dual inhibitor of EGFR/ErbB2 tyrosine kinase with the advantage of oral dosability and antitumor effects.

Formula: C₂₈H₂₅ClFN₅O₃S₂

Purity: 98.68%

Color and Shape: Soild

Molecular weight: 598.11

Ref: TM-T22827L