CymitQuimica logo

CAS 388088-77-5

:

4-(4-chlorophenyl)-1,2,3-thiadiazol-5-amine

Description:
4-(4-Chlorophenyl)-1,2,3-thiadiazol-5-amine is a chemical compound characterized by its thiadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and one sulfur atom. The presence of a 4-chlorophenyl group indicates that there is a chlorinated phenyl substituent attached to the thiadiazole ring, specifically at the 4-position. This compound is typically recognized for its potential biological activity, making it of interest in pharmaceutical research. It may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further studies. The amine functional group at the 5-position of the thiadiazole ring contributes to its reactivity and solubility in various solvents. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are common in organic synthesis. Overall, 4-(4-chlorophenyl)-1,2,3-thiadiazol-5-amine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C8H6ClN3S
InChI:InChI=1/C8H6ClN3S/c9-6-3-1-5(2-4-6)7-8(10)13-12-11-7/h1-4H,10H2
InChI key:CWWWFWUOEYNACY-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1c(N)snn1)Cl
Found 2 products.