CAS 388088-79-7

[5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolyl]methanol

Description:

[5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolyl]methanol, with the CAS number 388088-79-7, is a chemical compound characterized by its unique structural features that include a thiazole ring and an isoxazole moiety. The presence of these heterocyclic rings contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is likely to exhibit polar characteristics due to the hydroxymethyl group, which can influence its solubility and reactivity. Additionally, the thiazole and isoxazole rings may participate in various chemical interactions, such as hydrogen bonding and π-π stacking, which can be relevant in drug design and development. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities would be necessary to fully understand its potential uses and safety profile.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-5-9-7(4-13-5)8-2-6(3-11)10-12-8/h2,4,11H,3H2,1H3

SMILES: Cc1nc(cs1)c1cc(CO)no1

Synonyms:

• [5-(2-Methyl-1,3-Thiazol-4-Yl)Isoxazol-3-Yl]Methanol

[5-(2-Methyl-1,3-thiazol-4-yl)isoxazol-3-yl]methanol

CAS: 388088-79-7

[5-(2-Methyl-1,3-thiazol-4-yl)isoxazol-3-yl]methanol

Purity: ≥95%

Molecular weight: 196.23g/mol

Ref: 54-OR23224