CAS 388095-22-5

1-[2-(Phenylmethoxy)ethyl]cyclopropanamine

Description:

1-[2-(Phenylmethoxy)ethyl]cyclopropanamine, identified by its CAS number 388095-22-5, is a chemical compound characterized by its unique structural features. It contains a cyclopropane ring, which contributes to its rigidity and potential for unique reactivity. The presence of a phenylmethoxy group indicates that it has an aromatic component, which can influence its electronic properties and interactions with biological targets. This compound is likely to exhibit moderate lipophilicity due to the phenyl group, which may affect its solubility in organic solvents and its permeability through biological membranes. Additionally, the amine functional group suggests potential for hydrogen bonding and interaction with various receptors or enzymes. The specific stereochemistry of the cyclopropane and the substituents can also play a crucial role in its biological activity and pharmacological profile. Overall, 1-[2-(Phenylmethoxy)ethyl]cyclopropanamine is of interest in medicinal chemistry for its potential applications in drug development, particularly in areas targeting the central nervous system or other therapeutic areas.

Formula: C₁₂H₁₇NO

InChI: InChI=1S/C12H17NO/c13-12(6-7-12)8-9-14-10-11-4-2-1-3-5-11/h1-5H,6-10,13H2

InChI key: InChIKey=LIHZSLPGGSIALW-UHFFFAOYSA-N

SMILES: C(COCC1=CC=CC=C1)C2(N)CC2

Synonyms:

• 1-(2-Phenylmethoxyethyl)cyclopropan-1-amine
• 1-[2-(Phenylmethoxy)ethyl]cyclopropanamine
• 1-[2-(Benzyloxy)ethyl]cyclopropanamine
• Cyclopropanamine, 1-[2-(phenylmethoxy)ethyl]-

1-[2-(Benzyloxy)ethyl]cyclopropan-1-amine

CAS: 388095-22-5

Versatile small molecule scaffold

Formula: C₁₂H₁₇NO

Purity: Min. 95%

Molecular weight: 191.27 g/mol

Ref: 3D-NQA09522