CAS 3881-21-8

2'-O-methylinosine

Description:

2'-O-methylinosine is a modified nucleoside that plays a significant role in various biological processes, particularly in the context of RNA structure and function. It is characterized by the presence of a methyl group at the 2' position of the ribose sugar, which enhances its stability and can influence the folding and interactions of RNA molecules. This modification is commonly found in tRNA and certain other RNA species, contributing to their functional properties. The chemical structure of 2'-O-methylinosine includes an inosine base, which is a purine nucleoside, and the methylation at the 2' position of the ribose sugar differentiates it from standard nucleosides. This modification can affect the binding affinity of RNA to proteins and other nucleic acids, thereby playing a crucial role in gene expression regulation and cellular processes. Additionally, 2'-O-methylinosine is of interest in therapeutic applications, particularly in the development of RNA-based drugs and vaccines, due to its ability to modulate immune responses.

Formula: C₁₁H₁₄N₄O₅

InChI: InChI=1/C11H14N4O5/c1-19-8-7(17)5(2-16)20-11(8)15-4-14-6-9(15)12-3-13-10(6)18/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)/t5-,7-,8-,11-/m1/s1

SMILES: CO[C@@H]1[C@@H]([C@@H](CO)O[C@H]1n1cnc2c1ncnc2O)O

Synonyms:

• 2'-(O-Methyl)-Inosine

2'-(o-Methyl)-inosine

CAS: 3881-21-8

Formula: C₁₁H₁₄N₄O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 282.2527

Ref: IN-DA00C0LY

2'-O-Methylinosine

CAS: 3881-21-8

2'-O-Methylinosine

Purity: ≥98%

Molecular weight: 282.25g/mol

Ref: 54-BUP17929

2''-O-Methylinosine

CAS: 3881-21-8

Formula: C₁₁H₁₄N₄O₅

Molecular weight: 282.25

Ref: 7W-GN6215

2'-O-Methylinosine

CAS: 3881-21-8

2'-O-Methylinosine (2'-(o-Methyl)-inosine) is an orally bioavailable purine nucleoside analog with antihypertensive activity.

Formula: C₁₁H₁₄N₄O₅

Purity: 99.88%

Color and Shape: Solid

Molecular weight: 282.25

Ref: TM-TNU0003

2′-O-Methylinosine

CAS: 3881-21-8

Purity: 98%

Molecular weight: 282.256

Ref: 10-F987850

2'-O-Methylinosine

CAS: 3881-21-8

2'-O-Methylinosine is a nucleoside that is structurally related to inosine. It has been shown to induce apoptotic cell death in HIV-infected cells by inhibiting the synthesis of rRNA and by inhibiting the activity of the transcriptase enzyme. 2'-O-Methylinosine has also been shown to inhibit the replication of RNA viruses, such as herpes simplex virus and cytomegalovirus, and it can be used as an experimental model for studying apoptosis. 2'-O-Methylinosine can be synthesized from inosine using a chromatographic method that utilizes hydroxylamine. The chemical structure of this nucleoside is amphipathic, which allows it to bind both DNA and RNA strands.

Formula: C₁₁H₁₄N₄O₅

Purity: Min. 99 Area-%

Color and Shape: White Powder

Molecular weight: 282.25 g/mol

Ref: 3D-NM05162