CymitQuimica logo

CAS 38817-29-7

:

1-(5-deoxy-5-fluoropentofuranosyl)pyrimidine-2,4(1H,3H)-dione

Description:
1-(5-deoxy-5-fluoropentofuranosyl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 38817-29-7, is a synthetic nucleoside analog that exhibits structural features characteristic of both pyrimidine and furanose components. This compound contains a pyrimidine ring substituted with a dione functional group, which contributes to its potential biological activity. The presence of a fluorine atom at the 5-position of the furanose sugar enhances its stability and may influence its interaction with biological targets, such as nucleic acid synthesis enzymes. The 5-deoxy modification suggests that it lacks a hydroxyl group at the 5-position, which can affect its solubility and reactivity. This compound is of interest in medicinal chemistry and pharmacology, particularly in the development of antiviral or anticancer agents, as nucleoside analogs often mimic natural nucleosides and can interfere with nucleic acid metabolism. Its specific properties, such as solubility, melting point, and biological activity, would require further investigation through experimental studies.
Formula:C9H11FN2O5
InChI:InChI=1/C9H11FN2O5/c10-3-4-6(14)7(15)8(17-4)12-2-1-5(13)11-9(12)16/h1-2,4,6-8,14-15H,3H2,(H,11,13,16)
SMILES:c1cn(C2C(C(C(CF)O2)O)O)c(=O)nc1O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.