CAS 38819-01-1: Cellotetraose
Description:Cellotetraose is a carbohydrate composed of four glucose units linked by β-1,4-glycosidic bonds, making it a member of the cellulose family. It is a linear oligosaccharide and is classified as a cellooligosaccharide. Cellotetraose is typically derived from the hydrolysis of cellulose, a major component of plant cell walls. This compound is soluble in water and exhibits properties characteristic of polysaccharides, such as being non-reducing due to the presence of glycosidic linkages at both ends of the molecule. Its structure allows it to participate in various biochemical processes, including serving as a substrate for specific enzymes like cellulases, which break down cellulose into simpler sugars. Cellotetraose has applications in research, particularly in studies related to carbohydrate metabolism and the development of biofuels, as well as in the food industry for its potential prebiotic effects. Its CAS number, 38819-01-1, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C24H42O21
InChI:InChI=1S/C24H42O21/c25-1-6(30)11(32)19(7(31)2-26)43-23-17(38)14(35)21(9(4-28)41-23)45-24-18(39)15(36)20(10(5-29)42-24)44-22-16(37)13(34)12(33)8(3-27)40-22/h1,6-24,26-39H,2-5H2/t6-,7+,8+,9+,10+,11+,12+,13-,14+,15+,16+,17+,18+,19+,20+,21+,22-,23-,24-/m0/s1
InChI key:InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
SMILES:O=CC(O)C(O)C(OC1OC(CO)C(OC2OC(CO)C(OC3OC(CO)C(O)C(O)C3O)C(O)C2O)C(O)C1O)C(O)CO
- Synonyms:
- D-Glucose, O-β-D-glucopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→4)-
- Cellotetraose
- O-β-D-Glucopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→4)-D-glucose
- Cellotetrose
