CAS 38819-10-2: 2-amino-9-(beta-D-arabinofuranosyl)-3,9-dihydro-6H-purin-6-one
Description:2-amino-9-(beta-D-arabinofuranosyl)-3,9-dihydro-6H-purin-6-one, commonly known as Ara-A or arabinosyladenine, is a nucleoside analog with notable antiviral properties. It is characterized by its purine base structure, which includes an amino group at the 2-position and a beta-D-arabinofuranosyl sugar moiety. This compound exhibits a unique stereochemistry that contributes to its biological activity, particularly in inhibiting viral replication. Ara-A is primarily utilized in the treatment of viral infections, including those caused by herpes simplex virus and other RNA viruses. Its mechanism of action involves interference with viral nucleic acid synthesis, making it a valuable therapeutic agent. The compound is typically administered in its phosphate form to enhance solubility and bioavailability. Additionally, Ara-A has been studied for its potential in cancer therapy due to its ability to disrupt cellular processes. Overall, its structural features and biological activities make it a significant compound in medicinal chemistry and virology.
Formula:C10H13N5O5
InChI:InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6+,9-/m1/s1
InChI key:InChIKey=NYHBQMYGNKIUIF-FJFJXFQQSA-N
SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(CO)C(O)C3O
- Synonyms:
- 1-β-D-Arabinofuranosylguanine
- 2-Amino-6-hydroxy-9-(β-<span class="text-smallcaps">D</span>-arabinofuranosyl)purine
- 2-Amino-9-(beta-D-arabinofuranosyl)-1,9-dihydro-6H-purin-6-one
- 2-Amino-9-β-<span class="text-smallcaps">D</span>-arabinofuranosyl-1,9-dihydro-6H-purin-6-one
- 6H-Purin-6-one, 2-amino-9-β-<span class="text-smallcaps">D</span>-arabinofuranosyl-1,9-dihydro-
- 6H-purin-6-one, 2-amino-9-beta-D-arabinofuranosyl-1,9-dihydro-
- 9-(Beta-D-Arabinofuranosyl)Guanine
- 9-Arabinoguanine
- 9-β-<span class="text-smallcaps">D</span>-Arabinofuranosylguanine
- A 4233
- See more synonyms
- Arabinoguanosine
- Araguanosine
- Guanine arabinoside
- Guanine, 9-β-<span class="text-smallcaps">D</span>-arabinofuranosyl-
- NSC 76352
- ara-Guanosine
