CAS 3884-33-1

4-(4-bromophenyl)-2-chloro-thiazole

Description:

4-(4-Bromophenyl)-2-chloro-thiazole, with the CAS number 3884-33-1, is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a bromophenyl group at the 4-position and a chlorine atom at the 2-position of the thiazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents, such as bromine and chlorine, can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds like this one are often studied for their biological activities, as thiazole derivatives are known to possess antimicrobial, antifungal, and anticancer properties. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-(4-bromophenyl)-2-chloro-thiazole is of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₉H₅BrClNS

InChI: InChI=1/C9H5BrClNS/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H

SMILES: c1cc(ccc1c1csc(Cl)n1)Br

Synonyms:

• 4-(4-Bromophenyl)-2-chloro-1,3-thiazole
• Thiazole, 4-(4-Bromophenyl)-2-Chloro-

4-(4-Bromophenyl)-2-chloro-1,3-thiazole

CAS: 3884-33-1

Formula: C₉H₅BrClNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 274.5647

Ref: IN-DA003GW9

4-(4-Bromophenyl)-2-chloro-1,3-thiazole

CAS: 3884-33-1

4-(4-Bromophenyl)-2-chloro-1,3-thiazole

Purity: 97%

Molecular weight: 274.57g/mol

Ref: 54-OR1042463

4-(4-Bromophenyl)-2-chlorothiazole

CAS: 3884-33-1

Formula: C₉H₅BrClNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 274.56

Ref: 10-F431075