CAS 3884-95-5
:2-(1,1,3,3-Tetramethylbutyl)phenol
Description:
2-(1,1,3,3-Tetramethylbutyl)phenol, commonly known as a nonylphenol derivative, is an organic compound characterized by its phenolic structure with a bulky alkyl substituent. This compound typically appears as a viscous liquid or solid, depending on temperature, and is known for its hydrophobic properties due to the large alkyl group. It is often used as an intermediate in the production of surfactants, antioxidants, and other industrial chemicals. The presence of the bulky tetramethylbutyl group enhances its stability and reduces volatility, making it useful in various applications, including plastics and rubber manufacturing. However, it is important to note that nonylphenol and its derivatives have raised environmental and health concerns due to their endocrine-disrupting properties, leading to regulatory scrutiny in many regions. As such, handling and disposal of this compound require adherence to safety guidelines to mitigate potential risks to human health and the environment.
Formula:C14H22O
InChI:InChI=1S/C14H22O/c1-13(2,3)10-14(4,5)11-8-6-7-9-12(11)15/h6-9,15H,10H2,1-5H3
InChI key:InChIKey=XSXWOBXNYNULJG-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(C)(C)C1=C(O)C=CC=C1
Synonyms:- Phenol, o-(1,1,3,3-tetramethylbutyl)-
- Phenol, 2-(1,1,3,3-tetramethylbutyl)-
- o-(1,1,3,3-Tetramethylbutyl)phenol
- o-tert-Octylphenol
- 2-(1,1,3,3-Tetramethylbutyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
