CAS 38853-67-7

(±)-Sinactine

Description:

(±)-Sinactine, with the CAS number 38853-67-7, is a chemical compound that belongs to the class of natural products known as alkaloids. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound is typically derived from certain plant sources and exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects. The "(±)" notation indicates that sinactine exists as a racemic mixture, containing both enantiomers, which may exhibit different biological activities. Its solubility properties can vary depending on the solvent, and it is often studied for its interactions with biological systems, particularly in the context of drug development. As with many alkaloids, sinactine's mechanism of action may involve modulation of neurotransmitter systems or other cellular pathways, making it a subject of interest in medicinal chemistry and pharmacology.

Formula: C₂₀H₂₁NO₄

InChI: InChI=1S/C20H21NO4/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3

InChI key: InChIKey=UWEHVAXMSWXKRW-UHFFFAOYSA-N

SMILES: O(C)C=1C=C2C3N(CC=4C(C3)=CC=C5C4OCO5)CCC2=CC1OC

Synonyms:

• (±)-Sinactine
• Epiberberine, tetrahydro-
• Sinactine
• 6,6a,11,14-Tetrahydro-8,9-dimethoxy-12H-benzo[a]-1,3-benzodioxolo[4,5-g]quinolizine
• 12H-Benzo[a]-1,3-benzodioxolo[4,5-g]quinolizine, 6,6a,11,14-tetrahydro-8,9-dimethoxy-

Tetrahydroepiberberine

CAS: 38853-67-7

Tetrahydroepiberberine

Purity: ≥95%

Molecular weight: 339.39g/mol

Ref: 54-BUP01515

Tetrahydroepiberberine

CAS: 38853-67-7

Formula: C₂₀H₂₁NO₄

Molecular weight: 339.39

Ref: 7W-GY2653

Tetrahydroepiberberine

CAS: 38853-67-7

Formula: C₂₀H₂₁NO₄

Purity: 95%~99%

Color and Shape: Cryst.

Molecular weight: 339.391

Ref: BP-BP1623

Tetrahydroepiberberine

CAS: 38853-67-7

Tetrahydroepiberberine, an isoquinoline alkaloid, has antifungal and selective inhibition against the PI-3 virus activities.

Formula: C₂₀H₂₁NO₄

Purity: 97.56% - 99.93%

Color and Shape: Yellow Solid

Molecular weight: 339.39

Ref: TM-T8187

Tetrahydroepiberberine

CAS: 38853-67-7

Tetrahydroepiberberine is a plant-origin alkaloid, which is extracted from various traditional medicinal plants, particularly those found within the Berberis species. It functions through modulation of specific biological pathways and receptor interactions, which include dopaminergic and opioid receptors. This mode of action suggests it might influence neurotransmitter systems in the body.

Formula: C₂₀H₂₁NO₄

Purity: Min. 95%

Molecular weight: 339.4 g/mol

Ref: 3D-NBA85367