CymitQuimica logo

CAS 38854-94-3

:

(R)-1-Benzyl-5-carboxy-2-pyrrolidine

Description:
(R)-1-Benzyl-5-carboxy-2-pyrrolidine, with the CAS number 38854-94-3, is a chiral organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a benzyl group and a carboxylic acid functional group contributes to its unique chemical properties. This compound is typically studied in the context of medicinal chemistry and drug development due to its potential biological activity. The chirality of the molecule indicates that it exists in two enantiomeric forms, with the (R) configuration being one of them, which can significantly influence its pharmacological effects. Its solubility and reactivity can vary depending on the solvent and conditions, making it important for applications in synthesis and formulation. Additionally, the compound may exhibit interactions with biological targets, which can be explored for therapeutic purposes. Overall, (R)-1-Benzyl-5-carboxy-2-pyrrolidine is of interest in various fields, including organic synthesis, pharmacology, and medicinal chemistry.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c14-11-7-6-10(12(15)16)13(11)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,15,16)/t10-/m1/s1
InChI key:MOHLVDJRXGVGOM-SNVBAGLBSA-N
SMILES:C1CC(=O)N([C@H]1C(=O)O)CC2=CC=CC=C2
Found 4 products.