CAS 38858-89-8
:3,5-dinitro-1H-pyrazole
Description:
3,5-Dinitro-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which is substituted at the 3 and 5 positions with nitro groups. This compound is typically a yellow crystalline solid and is known for its energetic properties, making it of interest in the field of explosives and propellants. It has a relatively high melting point and is soluble in organic solvents, but less so in water. The presence of nitro groups contributes to its stability and reactivity, as they can participate in various chemical reactions, including reduction and substitution. 3,5-Dinitro-1H-pyrazole is also studied for its potential applications in agriculture as a herbicide and in materials science for developing new energetic materials. Safety considerations are important when handling this compound, as it can be hazardous due to its explosive nature and toxicity. Proper storage and handling protocols should be followed to mitigate risks associated with its use.
Formula:C3H2N4O4
InChI:InChI=1/C3H2N4O4/c8-6(9)2-1-3(5-4-2)7(10)11/h1H,(H,4,5)
SMILES:c1c([nH]nc1N(=O)=O)N(=O)=O
Synonyms:- 1H-pyrazole, 3,5-dinitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,5-Dinitro-1H-pyrazole
CAS:<p>3,5-Dinitro-1H-pyrazole is a chemical compound with the molecular formula C6H3N3O2. It is the simplest member of the class of dinitrophenols and is an aliphatic nitro compound. 3,5-Dinitro-1H-pyrazole has been shown to inhibit cancer cell growth in vitro. The mechanism of this anticancer activity is not known. 3,5-Dinitro-1H-pyrazole undergoes nucleophilic substitution reactions with hydrochloric acid, iodination reaction with sodium iodide, and reaction solution with potassium hydroxide. This compound also produces a solid catalyst when reacted with nitric acid or ammonia and can be used for optimal reactions at acidic environments. The nitrogen atoms on the pyrazole ring are nucleophilic, which means that they are capable of attacking other molecules such as aliphatic hydrocarbons and amines. This property makes</p>Formula:C3H2N4O4Purity:(¹H-Nmr) Min. 95 Area-%Color and Shape:PowderMolecular weight:158.07 g/mol


