CAS 38858-90-1

4-methyl-3-nitro-1H-pyrazole

Description:

4-Methyl-3-nitro-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl group at the 4-position and a nitro group at the 3-position of the pyrazole ring, contributing to its chemical reactivity and properties. It is typically a crystalline solid and may exhibit moderate solubility in polar organic solvents. The presence of the nitro group imparts significant electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, 4-methyl-3-nitro-1H-pyrazole can be utilized in the synthesis of other chemical compounds and may have applications in agrochemicals or pharmaceuticals. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and oxygen atoms, and its properties can be influenced by the functional groups attached to the pyrazole ring. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₄H₅N₃O₂

InChI: InChI=1S/C4H5N3O2/c1-3-2-5-6-4(3)7(8)9/h2H,1H3,(H,5,6)

SMILES: Cc1c[nH]nc1N(=O)=O

Synonyms:

• 1H-Pyrazole, 4-methyl-3-nitro-
• 4-Methyl-3-nitropyrazole

4-Methyl-3-nitro-1H-pyrazole

CAS: 38858-90-1

Formula: C₄H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 127.1014

Ref: IN-DA0037AS

4-Methyl-5-nitro-1H-pyrazole

CAS: 38858-90-1

4-Methyl-5-nitro-1H-pyrazole

Formula: C₄H₅N₃O₂

Purity: ≥95%

Color and Shape: off white to faint beige crystalline crystals

Molecular weight: 127.10g/mol

Ref: 54-OR302333

4-Methyl-3-nitro-1H-pyrazole

CAS: 38858-90-1

4-Methyl-3-nitro-1H-pyrazole

Purity: 97%

Molecular weight: 127.10g/mol

Ref: 54-OR307254

4-methyl-5-nitro-1H-pyrazole

CAS: 38858-90-1

Formula: C₄H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 127.103

Ref: 10-F371038