CAS 38869-49-7
:Piperazine, 1-(2-methoxyphenyl)-, hydrochloride (1:2)
Description:
Piperazine, 1-(2-methoxyphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a methoxyphenyl substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the methoxy group can influence the compound's lipophilicity and interaction with biological targets, making it of interest in medicinal chemistry. Piperazine derivatives are known for their diverse pharmacological effects, including anxiolytic, antidepressant, and antipsychotic activities. The specific structural characteristics of this compound may also suggest potential applications in the treatment of various neurological disorders. Safety and handling precautions should be observed, as with all chemical substances, and its use should be guided by appropriate regulatory standards.
Formula:C11H16N2O·2ClH
InChI:InChI=1S/C11H16N2O.2ClH/c1-14-11-5-3-2-4-10(11)13-8-6-12-7-9-13;;/h2-5,12H,6-9H2,1H3;2*1H
InChI key:InChIKey=ZGWQDMTYAQEMHA-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)N2CCNCC2.Cl
Synonyms:- 1-(2-Methoxyphenyl)piperazine dihydrochloride
- Piperazine, 1-(2-methoxyphenyl)-, dihydrochloride
- N-(2-Methoxyphenyl)piperazine dihydrochloride
- Piperazine, 1-(2-methoxyphenyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

