CAS 38876-67-4

2-bromo-6-nitrobenzoic acid

Description:

2-Bromo-6-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a bromine and a nitro group on the benzene ring. The bromine atom is located at the second position, while the nitro group is situated at the sixth position relative to the carboxylic acid functional group. This compound typically appears as a yellow crystalline solid and is soluble in organic solvents, with limited solubility in water. Its molecular structure contributes to its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the nitro group enhances its electrophilic character, while the carboxylic acid group provides acidic properties. 2-Bromo-6-nitrobenzoic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.

Formula: C₇H₄BrNO₄

InChI: InChI=1/C7H4BrNO4/c8-4-2-1-3-5(9(12)13)6(4)7(10)11/h1-3H,(H,10,11)

SMILES: c1cc(c(c(c1)N(=O)=O)C(=O)O)Br

Synonyms:

• Benzoic Acid, 2-Bromo-6-Nitro-
• 2-Bromo-6-nitrobenzoic acid

2-Bromo-6-nitrobenzoic acid

CAS: 38876-67-4

Formula: C₇H₄BrNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 246.0150

Ref: IN-DA00C77B

2-Bromo-6-nitrobenzoic acid

CAS: 38876-67-4

2-Bromo-6-nitrobenzoic acid

Formula: C₇H₄BrNO₄

Purity: ≥95%

Color and Shape: faint yellow. wooly powder

Molecular weight: 246.01g/mol

Ref: 54-OR55195

2-Bromo-6-nitrobenzoic acid

CAS: 38876-67-4

Formula: C₇H₄BrNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 246.016

Ref: 10-F078158