CAS 38876-70-9
:2-Bromo-6-hydroxybenzoic acid
Description:
2-Bromo-6-hydroxybenzoic acid is an aromatic compound characterized by the presence of a bromine atom and a hydroxyl group on a benzoic acid framework. The bromine substituent is located at the second position, while the hydroxyl group is at the sixth position of the benzene ring, contributing to its unique reactivity and properties. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid and hydroxyl functional groups. It exhibits acidic behavior, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitutions. The presence of the bromine atom can also enhance its reactivity in electrophilic aromatic substitution reactions. Additionally, 2-Bromo-6-hydroxybenzoic acid may have applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its specific physical and chemical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage due to potential hazards associated with brominated compounds.
Formula:C7H5BrO3
InChI:InChI=1/C7H5BrO3/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,9H,(H,10,11)
SMILES:c1cc(c(c(c1)O)C(=O)O)Br
Synonyms:- Benzoic Acid, 2-Bromo-6-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-6-hydroxy benzoic acid
CAS:Formula:C7H5BrO3Purity:98%Color and Shape:SolidMolecular weight:217.01682-Bromo-6-hydroxybenzoic acid
CAS:2-Bromo-6-hydroxybenzoic acidFormula:C7H5BrO3Purity:98%Color and Shape: faint beige powderMolecular weight:217.02g/mol2-Bromo-6-hydroxybenzoic acid
CAS:<p>2-Bromo-6-hydroxybenzoic acid is a nucleophilic compound with a bromine atom at the 2 position. It is used in organic synthesis as a building block in the preparation of amides and other functional groups. This efficient preparation can be achieved by treating anilines with sodium nitrite and hydroxylamine in ethanol.</p>Formula:C7H5BrO3Purity:Min. 95%Molecular weight:217.02 g/mol




