CAS 389-31-1

2-Fluoromandelic acid

Description:

2-Fluoromandelic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom at the second position of the mandelic acid structure. Its molecular formula is C9H9FO3, and it features a phenyl group attached to a carbon bearing both a hydroxyl and a carboxylic acid functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the fluorine atom can influence its reactivity and biological activity, making it of interest in medicinal chemistry and organic synthesis. 2-Fluoromandelic acid can participate in various chemical reactions, including esterification and nucleophilic substitution, and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its unique properties and structural features make it a valuable compound for research and industrial applications.

Formula: C₈H₇FO₃

InChI: InChI=1/C8H7FO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7,10H,(H,11,12)

SMILES: c1ccc(c(c1)C(C(=O)O)O)F

Synonyms:

• (2-Fluorophenyl)(hydroxy)acetic acid
• Benzeneacetic acid, 2-fluoro-alpha-hydroxy-

2-Fluoromandelic Acid

CAS: 389-31-1

Formula: C₈H₇FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.1378

Ref: IN-DA003HBY

2-Fluoromandelic acid

CAS: 389-31-1

2-Fluoromandelic acid

Purity: 98%

Molecular weight: 170.14g/mol

Ref: 54-PC10363

2-Fluoromandelic acid

CAS: 389-31-1

Formula: C₈H₇FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.139

Ref: 10-F009726

2-Fluoro-DL-mandelic Acid

CAS: 389-31-1

Formula: C₈H₇FO₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 170.14

Ref: 3B-F0730