CAS 389125-71-7

Pipendoxifene hydrochloride hydrate

Description:

Pipendoxifene hydrochloride hydrate is a chemical compound primarily studied for its potential applications in the treatment of various medical conditions, particularly in the field of oncology. It is a selective estrogen receptor modulator (SERM), which means it can bind to estrogen receptors and exert either estrogenic or anti-estrogenic effects depending on the target tissue. This dual action makes it a candidate for therapeutic use in hormone-related cancers. The compound is typically presented as a hydrochloride salt, which enhances its solubility and stability in aqueous solutions. As a hydrate, it contains water molecules in its crystalline structure, which can influence its physical properties, such as melting point and solubility. The molecular structure of Pipendoxifene includes specific functional groups that contribute to its biological activity and pharmacokinetics. Safety and efficacy studies are essential to determine its therapeutic potential and side effects in clinical settings. Overall, Pipendoxifene hydrochloride hydrate represents a significant area of research in medicinal chemistry and pharmacology.

Formula: C₂₉H₃₅ClN₂O₄

InChI: InChI=1/C29H32N2O3.ClH.H2O/c1-21-27-19-25(33)11-14-28(27)31(29(21)23-7-9-24(32)10-8-23)20-22-5-12-26(13-6-22)34-18-17-30-15-3-2-4-16-30;;/h5-14,19,32-33H,2-4,15-18,20H2,1H3;1H;1H2

SMILES: Cc1c2cc(ccc2n(Cc2ccc(cc2)OCCN2CCCCC2)c1c1ccc(cc1)O)O.Cl.O

Synonyms:

• 2-(4-Hydroxyphenyl)-3-methyl-1-[4-[2-(1-piperidinyl)ethoxy]benzyl]-1H-indol-5-ol hydrochloride hydrate
• 2-(4-hydroxyphenyl)-3-methyl-1-{4-[2-(piperidin-1-yl)ethoxy]benzyl}-1H-indol-5-ol hydrochloride hydrate