CAS 38917-61-2
:5H-Cyclopentapyrazine,6,7-dihydro-2,5-dimethyl-
Description:
5H-Cyclopentapyrazine, 6,7-dihydro-2,5-dimethyl- is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazine ring fused to a cyclopentane moiety. This compound features two methyl groups at the 2 and 5 positions of the pyrazine ring, contributing to its distinct chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of nitrogen atoms in the pyrazine ring imparts basicity and potential for various chemical interactions, making it of interest in synthetic organic chemistry and potentially in pharmaceuticals. Its molecular structure allows for various functionalization possibilities, which can lead to derivatives with diverse biological activities. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and environmental conditions, influencing its applications in research and industry. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-6-3-4-8-9(6)10-5-7(2)11-8/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=CTFGVWCFSGCLHZ-UHFFFAOYSA-N
SMILES:CC1C=2C(CC1)=NC(C)=CN2
Synonyms:- 2,5-Dimethyl-5H,6H,7H-cyclopenta[b]pyrazine
- 2,5-Dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine
- 2,5-Dimethyl-6,7-dihydro-5H-cyclopentapyrazine
- 6,7-Dihydro-2,5-dimethyl-5H-cyclopentapyrazine
- 5H-Cyclopentapyrazine, 6,7-dihydro-2,5-dimethyl-
- 6,7-dimethyl dihydrocyclopentapyrazine
- 6,7-Dihydro-2(3),5-dimethyl-5H-cyclopenta[b]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.