CAS 38922-75-7
:2-[1,1′-Biphenyl]-4-ylimidazo[1,2-a]pyridine
Description:
2-[1,1′-Biphenyl]-4-ylimidazo[1,2-a]pyridine, with the CAS number 38922-75-7, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a biphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its ring structure. It may display fluorescence and has been studied for its interactions in various chemical environments. The presence of the biphenyl moiety can enhance its stability and solubility in organic solvents. Additionally, compounds of this type are often investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Its synthesis may involve multi-step organic reactions, and it is important to handle it with care, following appropriate safety protocols due to the potential for toxicity or reactivity. Overall, 2-[1,1′-Biphenyl]-4-ylimidazo[1,2-a]pyridine represents a significant compound in the field of medicinal chemistry and materials science.
Formula:C19H14N2
InChI:InChI=1S/C19H14N2/c1-2-6-15(7-3-1)16-9-11-17(12-10-16)18-14-21-13-5-4-8-19(21)20-18/h1-14H
InChI key:InChIKey=TUKLCPMARFSNQI-UHFFFAOYSA-N
SMILES:C1(=CN2C(=N1)C=CC=C2)C3=CC=C(C=C3)C4=CC=CC=C4
Synonyms:- Imidazo[1,2-a]pyridine, 2-[1,1′-biphenyl]-4-yl-
- 2-[1,1′-Biphenyl]-4-ylimidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
