CAS 38932-72-8

1,1-Cyclopentanedimethanamine

Description:

1,1-Cyclopentanedimethanamine, with the CAS number 38932-72-8, is an organic compound characterized by its cyclic structure and amine functional groups. It features a cyclopentane ring with two methanamine groups attached to the same carbon atom, making it a diamine. This compound is typically colorless to pale yellow and may have a distinct amine odor. It is soluble in water and various organic solvents, which is common for amines due to their ability to form hydrogen bonds. The presence of two amine groups allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and polymerization processes. Additionally, 1,1-Cyclopentanedimethanamine may exhibit basic properties, making it a potential candidate for applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks.

Formula: C₇H₁₆N₂

InChI: InChI=1S/C7H16N2/c8-5-7(6-9)3-1-2-4-7/h1-6,8-9H2

InChI key: InChIKey=CSMSTXROIMQHME-UHFFFAOYSA-N

SMILES: C(N)C1(CN)CCCC1

Synonyms:

• 1,1-Bis(aminomethyl)cyclopentane
• 1,1-Cyclopentanedimethaneamine
• [1-(Aminomethyl)cyclopentyl]methanamine
• 1,1-Cyclopentanedimethanamine

[1-(Aminomethyl)cyclopentyl]methanamine

CAS: 38932-72-8

Versatile small molecule scaffold

Formula: C₇H₁₆N₂

Purity: Min. 95%

Molecular weight: 128.22 g/mol

Ref: 3D-NBA93272