CAS 38937-80-3
:Glycine, glycylglycyl-N-methyl-
Description:
Glycine, glycylglycyl-N-methyl- is a synthetic compound that belongs to the class of amino acids and peptides. It is characterized by the presence of a glycine backbone, which is the simplest amino acid, and features a methyl group attached to the nitrogen atom of the peptide bond. This modification can influence its solubility and biological activity. The compound is typically white to off-white in appearance and is soluble in water, making it suitable for various biochemical applications. Glycine derivatives are often studied for their roles in protein synthesis, neurotransmission, and as potential therapeutic agents. The presence of the N-methyl group may enhance its stability and alter its interaction with biological systems. As with many amino acid derivatives, it may exhibit properties such as low toxicity and biocompatibility, making it of interest in pharmaceutical and nutritional contexts. However, specific applications and effects would depend on further research and characterization of this compound.
Formula:C7H13N3O4
InChI:InChI=1S/C7H13N3O4/c1-10(4-7(13)14)6(12)3-9-5(11)2-8/h2-4,8H2,1H3,(H,9,11)(H,13,14)
InChI key:InChIKey=WTUVOOODVFIARR-UHFFFAOYSA-N
SMILES:C(N(CC(O)=O)C)(CNC(CN)=O)=O
Synonyms:- 2-[2-(2-Aminoacetamido)-N-methylacetamido]acetic acid
- NSC 334197
- Glycine, glycylglycyl-N-methyl-
- Glycylglycylsarcosine
- Glycine, N-(N-glycylglycyl)-N-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Gly-Gly-Sar-OH
CAS:<p>Gly-Gly-Sar is a synthetic peptide that acts as a substrate for the peptide transporter, which is part of the membrane of cells. It is an amide with a reactive group that can form a ternary complex with two hydroxyl ions and one proton. Gly-Gly-Sar has been shown to be taken up by caco-2 cells in an extravesicular manner and undergoes proteolysis by peptidases. This leads to bond cleavage and formation of free Gly-Gly and Sar. The free Gly and Gly are then transported across the cell membrane into the cell cytoplasm, where they are hydroxylated by enzymes such as glycyl-l-leucine hydroxylase to form glycolic acid and glyoxylic acid, respectively.</p>Formula:C7H13N3O4Purity:Min. 95%Molecular weight:203.2 g/mol


