CAS 38945-01-6

thiophene-2-sulfinic acid

Description:

Thiophene-2-sulfinic acid is an organosulfur compound characterized by the presence of a thiophene ring, which is a five-membered aromatic ring containing one sulfur atom. This compound features a sulfinic acid functional group (-SO2H) attached to the second carbon of the thiophene ring, contributing to its unique chemical properties. Thiophene-2-sulfinic acid is typically a white to light yellow solid and is soluble in polar solvents such as water and alcohols. It exhibits acidic behavior due to the sulfinic acid group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The compound is of interest in organic synthesis and may serve as a precursor for the preparation of other sulfur-containing compounds. Additionally, its derivatives can have applications in pharmaceuticals and agrochemicals. Safety data indicates that, like many organosulfur compounds, it should be handled with care, as it may cause irritation upon contact with skin or eyes.

Formula: C₄H₄O₂S₂

InChI: InChI=1/C4H4O2S2/c5-8(6)4-2-1-3-7-4/h1-3H,(H,5,6)

SMILES: c1cc(sc1)S(=O)O

Sodium thiophene-2-sulfinate

CAS: 38945-01-6

Formula: C₄H₃NaO₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.1852

Ref: IN-DA019ZF3

Sodium Thiophene-2-Sulphinate

CAS: 38945-01-6

Sodium Thiophene-2-Sulphinate

Purity: 95%

Molecular weight: 170.18g/mol

Ref: 54-OR1015064

2-Thiophenesulfinic acid sodium salt

CAS: 38945-01-6

Formula: C₄H₃NaO₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.18

Ref: 10-F045968

Sodium thiophene-2-sulfinate

CAS: 38945-01-6

Sodium thiophene-2-sulfinate is a synthetic reagent that can be used to form methylenecyclopropanes, which are highly reactive with respect to oxidizing agents. A radical coupling mechanism has been proposed for the reaction of sodium thiophene-2-sulfinate with peroxide, which proceeds through a chain mechanism. The functional groups on the molecule allow for selective reactions with anilines and other electrophiles. This reagent is also effective in the synthesis of type-2 diabetes drugs and for investigating mechanistic aspects of these reactions.

Formula: C₄H₃NaO₂S₂

Purity: Min. 95%

Molecular weight: 170.2 g/mol

Ref: 3D-NBA94501