CAS 38948-28-6

4-[2-(4-Methyl-1-piperazinyl)ethoxy]benzenamine

Description:

4-[2-(4-Methyl-1-piperazinyl)ethoxy]benzenamine, with the CAS number 38948-28-6, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with an ethoxy group and a piperazine moiety, which is further substituted with a methyl group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine and ether functional groups. The piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the methyl group on the piperazine can influence its pharmacokinetic properties, such as lipophilicity and receptor binding affinity. Additionally, the compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including alkylation and acylation. Overall, 4-[2-(4-Methyl-1-piperazinyl)ethoxy]benzenamine is a versatile compound with potential applications in drug design and synthesis.

Formula: C₁₃H₂₁N₃O

InChI: InChI=1S/C13H21N3O/c1-15-6-8-16(9-7-15)10-11-17-13-4-2-12(14)3-5-13/h2-5H,6-11,14H2,1H3

InChI key: InChIKey=PODGLCSJCBYFGC-UHFFFAOYSA-N

SMILES: O(CCN1CCN(C)CC1)C2=CC=C(N)C=C2

Synonyms:

• 4-[[2-(4-Methyl-1-piperazinyl)ethyl]oxy]aniline
• 4-[2-(4-Methyl-1-piperazinyl)ethoxy]benzenamine
• 4-[2-(4-Methyl-1-piperazinyl)ethoxy]aniline
• [4-[2-(4-Methylpiperazin-1-yl)ethoxy]phenyl]amine
• Benzenamine, 4-[2-(4-methyl-1-piperazinyl)ethoxy]-

4-[2-(4-Methylpiperazin-1-yl)ethoxy]aniline

CAS: 38948-28-6

Versatile small molecule scaffold

Formula: C₁₃H₂₁N₃O

Purity: Min. 95%

Molecular weight: 235.33 g/mol

Ref: 3D-NBA94828