CymitQuimica logo

CAS 38953-42-3

:

4-Amino-6-chloro-5-pyrimidinol

Description:
4-Amino-6-chloro-5-pyrimidinol is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both amino and chloro functional groups. The presence of the amino group (-NH2) at the 4-position and the chloro group (-Cl) at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for pyrimidine derivatives. Its molecular structure allows for hydrogen bonding, influencing its interactions in biological systems. 4-Amino-6-chloro-5-pyrimidinol is of interest in pharmaceutical research, particularly for its potential as an intermediate in the synthesis of various bioactive compounds. Additionally, its properties may be leveraged in the development of antiviral or anticancer agents, given the role of pyrimidine derivatives in nucleic acid metabolism. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.
Formula:C4H4ClN3O
InChI:InChI=1/C4H4ClN3O/c5-3-2(9)4(6)8-1-7-3/h1,9H,(H2,6,7,8)
InChI key:PLOZXUFHBRJLFX-UHFFFAOYSA-N
SMILES:c1nc(c(c(=N)[nH]1)O)Cl
Synonyms:
  • 4-Amino-6-Chloropyrimidin-5-Ol
Found 4 products.